C23H26Cl2O6 — CID 122129537
[2-[(6S,8S,9S,10R,13S,14S,17R)-1,6-dichloro-17-hydroxy-10,13-dimethyl-3,11-dioxo-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate (PubChem CID 122129537) has the molecular formula C23H26Cl2O6 and a molecular weight of 469.36 g/mol. Its IUPAC name is [2-[(6S,8S,9S,10R,13S,14S,17R)-1,6-dichloro-17-hydroxy-10,13-dimethyl-3,11-dioxo-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate.
| Compound Name | [2-[(6S,8S,9S,10R,13S,14S,17R)-1,6-dichloro-17-hydroxy-10,13-dimethyl-3,11-dioxo-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 122129537 |
| Molecular Formula | C23H26Cl2O6 |
| Molecular Weight | 469.36 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | [2-[(6S,8S,9S,10R,13S,14S,17R)-1,6-dichloro-17-hydroxy-10,13-dimethyl-3,11-dioxo-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)[C@@]1(O)CC[C@H]2[C@@H]3C[C@H](Cl)C4=CC(=O)C=C(Cl)[C@]4(C)[C@H]3C(=O)C[C@@]21C |
| InChI | InChI=1S/C23H26Cl2O6/c1-11(26)31-10-19(29)23(30)5-4-14-13-8-16(24)15-6-12(27)7-18(25)22(15,3)20(13)17(28)9-21(14,23)2/h6-7,13-14,16,20,30H,4-5,8-10H2,1-3H3/t13-,14-,16-,20+,21-,22+,23-/m0/s1 |
| InChIKey | WJEKJGVSQHEYNW-DETSWKJISA-N |
| XLogP | 3.12 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|