C26H40O7 — CID 125030072
[(3R,5S,8R,9R,10S,12R,13R,14R,15S,17R)-12,15-diacetyloxy-17-methoxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 125030072) has the molecular formula C26H40O7 and a molecular weight of 464.60 g/mol. Its IUPAC name is [(3R,5S,8R,9R,10S,12R,13R,14R,15S,17R)-12,15-diacetyloxy-17-methoxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3R,5S,8R,9R,10S,12R,13R,14R,15S,17R)-12,15-diacetyloxy-17-methoxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 125030072 |
| Molecular Formula | C26H40O7 |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.28 |
| IUPAC Name | [(3R,5S,8R,9R,10S,12R,13R,14R,15S,17R)-12,15-diacetyloxy-17-methoxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CO[C@@H]1C[C@H](OC(C)=O)[C@@H]2[C@@H]3CC[C@H]4C[C@H](OC(C)=O)CC[C@]4(C)[C@@H]3C[C@@H](OC(C)=O)[C@]21C |
| InChI | InChI=1S/C26H40O7/c1-14(27)31-18-9-10-25(4)17(11-18)7-8-19-20(25)12-23(33-16(3)29)26(5)22(30-6)13-21(24(19)26)32-15(2)28/h17-24H,7-13H2,1-6H3/t17-,18+,19+,20+,21-,22+,23+,24-,25-,26+/m0/s1 |
| InChIKey | BJSZIYQPTILUHA-YLAACXFQSA-N |
| XLogP | 4.06 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|