C30H46O4 — CID 125030750
[(1R,2R,5R,7R,11R,14S,15R,17R)-14-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-7-hydroxy-2,15-dimethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-9-en-5-yl] acetate (PubChem CID 125030750) has the molecular formula C30H46O4 and a molecular weight of 470.69 g/mol. Its IUPAC name is [(1R,2R,5R,7R,11R,14S,15R,17R)-14-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-7-hydroxy-2,15-dimethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-9-en-5-yl] acetate.
| Compound Name | [(1R,2R,5R,7R,11R,14S,15R,17R)-14-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-7-hydroxy-2,15-dimethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-9-en-5-yl] acetate |
|---|---|
| PubChem CID | 125030750 |
| Molecular Formula | C30H46O4 |
| Molecular Weight | 470.69 g/mol |
| Exact Mass | 470.34 |
| IUPAC Name | [(1R,2R,5R,7R,11R,14S,15R,17R)-14-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-7-hydroxy-2,15-dimethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-9-en-5-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC[C@]2(C)[C@@](O)(CC=C3[C@@H]4CC[C@@H]([C@H](C)/C=C/[C@H](C)C(C)C)[C@@]4(C)C[C@H]4O[C@@]342)C1 |
| InChI | InChI=1S/C30H46O4/c1-18(2)19(3)8-9-20(4)23-10-11-24-25-13-15-29(32)16-22(33-21(5)31)12-14-28(29,7)30(25)26(34-30)17-27(23,24)6/h8-9,13,18-20,22-24,26,32H,10-12,14-17H2,1-7H3/b9-8+/t19-,20+,22+,23-,24-,26+,27+,28+,29+,30-/m0/s1 |
| InChIKey | ISNIOROLAGBPRX-ATNZUVSESA-N |
| XLogP | 6.23 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.69 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|