C31H51NO4 — CID 125032469
[(3S,5S,6Z,8R,9S,10R,13S,14S,17R)-6-acetyloxyimino-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 125032469) has the molecular formula C31H51NO4 and a molecular weight of 501.75 g/mol. Its IUPAC name is [(3S,5S,6Z,8R,9S,10R,13S,14S,17R)-6-acetyloxyimino-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,5S,6Z,8R,9S,10R,13S,14S,17R)-6-acetyloxyimino-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 125032469 |
| Molecular Formula | C31H51NO4 |
| Molecular Weight | 501.75 g/mol |
| Exact Mass | 501.38 |
| IUPAC Name | [(3S,5S,6Z,8R,9S,10R,13S,14S,17R)-6-acetyloxyimino-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O/N=C1/C[C@H]2[C@H](CC[C@@]3(C)[C@@H]([C@H](C)CCCC(C)C)CC[C@@H]23)[C@@]2(C)CC[C@H](OC(C)=O)C[C@H]12 |
| InChI | InChI=1S/C31H51NO4/c1-19(2)9-8-10-20(3)25-11-12-26-24-18-29(32-36-22(5)34)28-17-23(35-21(4)33)13-15-31(28,7)27(24)14-16-30(25,26)6/h19-20,23-28H,8-18H2,1-7H3/b32-29-/t20-,23+,24-,25-,26+,27+,28-,30+,31-/m1/s1 |
| InChIKey | XZLPTBXLHLBGFG-UFFPULOASA-N |
| XLogP | 7.57 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.75 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|