C29H48N2O2 — CID 135039684
[(3S,5S,6Z,10R,13R,17R)-6-diazo-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 135039684) has the molecular formula C29H48N2O2 and a molecular weight of 456.72 g/mol. Its IUPAC name is [(3S,5S,6Z,10R,13R,17R)-6-diazo-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,5S,6Z,10R,13R,17R)-6-diazo-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 135039684 |
| Molecular Formula | C29H48N2O2 |
| Molecular Weight | 456.72 g/mol |
| Exact Mass | 456.37 |
| IUPAC Name | [(3S,5S,6Z,10R,13R,17R)-6-diazo-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@]2(C)C3CC[C@@]4(C)C(CC[C@@H]4[C@H](C)CCCC(C)C)C3CC(=[N+]=[N-])[C@H]2C1 |
| InChI | InChI=1S/C29H48N2O2/c1-18(2)8-7-9-19(3)23-10-11-24-22-17-27(31-30)26-16-21(33-20(4)32)12-14-29(26,6)25(22)13-15-28(23,24)5/h18-19,21-26H,7-17H2,1-6H3/t19-,21+,22?,23-,24?,25?,26-,28-,29-/m1/s1 |
| InChIKey | CJUIGEMWASEVPP-ZGYOLGPESA-N |
| XLogP | 7.32 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.72 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|