C29H49NO3 — CID 101276933
[(1R,2S,5S,7R,11R,12R,15R,16R)-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]-9-oxo-10-azatetracyclo[9.7.0.02,7.012,16]octadecan-5-yl] acetate (PubChem CID 101276933) has the molecular formula C29H49NO3 and a molecular weight of 459.72 g/mol. Its IUPAC name is [(1R,2S,5S,7R,11R,12R,15R,16R)-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]-9-oxo-10-azatetracyclo[9.7.0.02,7.012,16]octadecan-5-yl] acetate.
| Compound Name | [(1R,2S,5S,7R,11R,12R,15R,16R)-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]-9-oxo-10-azatetracyclo[9.7.0.02,7.012,16]octadecan-5-yl] acetate |
|---|---|
| PubChem CID | 101276933 |
| Molecular Formula | C29H49NO3 |
| Molecular Weight | 459.72 g/mol |
| Exact Mass | 459.37 |
| IUPAC Name | [(1R,2S,5S,7R,11R,12R,15R,16R)-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]-9-oxo-10-azatetracyclo[9.7.0.02,7.012,16]octadecan-5-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)[C@@H](CC(=O)N[C@@H]3[C@@H]2CC[C@]2(C)[C@@H]([C@H](C)CCCC(C)C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C29H49NO3/c1-18(2)8-7-9-19(3)23-10-11-24-27-25(13-15-29(23,24)6)28(5)14-12-22(33-20(4)31)16-21(28)17-26(32)30-27/h18-19,21-25,27H,7-17H2,1-6H3,(H,30,32)/t19-,21-,22+,23-,24+,25+,27+,28+,29-/m1/s1 |
| InChIKey | HCAMWUKWPJQRBU-KIWQIYPESA-N |
| XLogP | 6.52 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.72 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |