C22H30O3 — CID 125035144
[(2R,4aS,4bR,10bS,12aR)-7-methoxy-4a-methyl-2,3,4,4b,5,6,10b,11,12,12a-decahydro-1H-chrysen-2-yl] acetate (PubChem CID 125035144) has the molecular formula C22H30O3 and a molecular weight of 342.48 g/mol. Its IUPAC name is [(2R,4aS,4bR,10bS,12aR)-7-methoxy-4a-methyl-2,3,4,4b,5,6,10b,11,12,12a-decahydro-1H-chrysen-2-yl] acetate.
| Compound Name | [(2R,4aS,4bR,10bS,12aR)-7-methoxy-4a-methyl-2,3,4,4b,5,6,10b,11,12,12a-decahydro-1H-chrysen-2-yl] acetate |
|---|---|
| PubChem CID | 125035144 |
| Molecular Formula | C22H30O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | [(2R,4aS,4bR,10bS,12aR)-7-methoxy-4a-methyl-2,3,4,4b,5,6,10b,11,12,12a-decahydro-1H-chrysen-2-yl] acetate |
| SMILES | COc1cccc2c1CC[C@@H]1[C@@H]2CC[C@@H]2C[C@H](OC(C)=O)CC[C@@]21C |
| InChI | InChI=1S/C22H30O3/c1-14(23)25-16-11-12-22(2)15(13-16)7-8-18-17-5-4-6-21(24-3)19(17)9-10-20(18)22/h4-6,15-16,18,20H,7-13H2,1-3H3/t15-,16-,18-,20-,22+/m1/s1 |
| InChIKey | NTOWCXZNUSRHKI-NGWXBRGBSA-N |
| XLogP | 4.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |