C22H27FO4 — CID 125035786
methyl (2E)-2-[(6R,8R,9R,10R,13R,14R)-6-fluoro-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-ylidene]acetate (PubChem CID 125035786) has the molecular formula C22H27FO4 and a molecular weight of 374.45 g/mol. Its IUPAC name is methyl (2E)-2-[(6R,8R,9R,10R,13R,14R)-6-fluoro-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(6R,8R,9R,10R,13R,14R)-6-fluoro-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-ylidene]acetate |
|---|---|
| PubChem CID | 125035786 |
| Molecular Formula | C22H27FO4 |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | methyl (2E)-2-[(6R,8R,9R,10R,13R,14R)-6-fluoro-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-ylidene]acetate |
| SMILES | COC(=O)/C=C1\CC[C@@H]2[C@H]3C[C@@H](F)C4=CC(=O)CC[C@]4(C)[C@@H]3C(=O)C[C@@]12C |
| InChI | InChI=1S/C22H27FO4/c1-21-7-6-13(24)9-16(21)17(23)10-14-15-5-4-12(8-19(26)27-3)22(15,2)11-18(25)20(14)21/h8-9,14-15,17,20H,4-7,10-11H2,1-3H3/b12-8+/t14-,15-,17-,20+,21+,22+/m1/s1 |
| InChIKey | RMDJMPHXGCYQJX-UHTSNGGFSA-N |
| XLogP | 3.74 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'steroid_A(2)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|