C22H27BrO4 — CID 6385100
methyl (2Z)-2-(2-bromo-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-ylidene)acetate (PubChem CID 6385100) has the molecular formula C22H27BrO4 and a molecular weight of 435.36 g/mol. Its IUPAC name is methyl (2Z)-2-(2-bromo-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-ylidene)acetate.
| Compound Name | methyl (2Z)-2-(2-bromo-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-ylidene)acetate |
|---|---|
| PubChem CID | 6385100 |
| Molecular Formula | C22H27BrO4 |
| Molecular Weight | 435.36 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | methyl (2Z)-2-(2-bromo-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-ylidene)acetate |
| SMILES | COC(=O)/C=C1/CCC2C3CCC4=CC(=O)C(Br)CC4(C)C3C(=O)CC12C |
| InChI | InChI=1S/C22H27BrO4/c1-21-11-18(25)20-14(15(21)7-5-13(21)9-19(26)27-3)6-4-12-8-17(24)16(23)10-22(12,20)2/h8-9,14-16,20H,4-7,10-11H2,1-3H3/b13-9- |
| InChIKey | VGARIQOMXRAOII-LCYFTJDESA-N |
| XLogP | 4.17 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.36 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'steroid_A(2)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|