C30H48O3Si — CID 134922449
(10R,13S,17Z)-10,13-dimethyl-17-(1-tripropylsilyloxyethylidene)-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,11-dione (PubChem CID 134922449) has the molecular formula C30H48O3Si and a molecular weight of 484.80 g/mol. Its IUPAC name is (10R,13S,17Z)-10,13-dimethyl-17-(1-tripropylsilyloxyethylidene)-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,11-dione.
| Compound Name | (10R,13S,17Z)-10,13-dimethyl-17-(1-tripropylsilyloxyethylidene)-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,11-dione |
|---|---|
| PubChem CID | 134922449 |
| Molecular Formula | C30H48O3Si |
| Molecular Weight | 484.80 g/mol |
| Exact Mass | 484.34 |
| IUPAC Name | (10R,13S,17Z)-10,13-dimethyl-17-(1-tripropylsilyloxyethylidene)-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,11-dione |
| SMILES | CCC[Si](CCC)(CCC)O/C(C)=C1/CCC2C3CCC4=CC(=O)CC[C@]4(C)C3C(=O)C[C@]12C |
| InChI | InChI=1S/C30H48O3Si/c1-7-16-34(17-8-2,18-9-3)33-21(4)25-12-13-26-24-11-10-22-19-23(31)14-15-29(22,5)28(24)27(32)20-30(25,26)6/h19,24,26,28H,7-18,20H2,1-6H3/b25-21-/t24?,26?,28?,29-,30+/m0/s1 |
| InChIKey | CITGVYKDASJPLJ-LAJQNBSBSA-N |
| XLogP | 8.16 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.80 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'steroid_A(2)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|