C23H30O5 — CID 154143087
2-[(8S,9S,10R,13S,14S)-16-hydroxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-ylidene]ethyl acetate (PubChem CID 154143087) has the molecular formula C23H30O5 and a molecular weight of 386.49 g/mol. Its IUPAC name is 2-[(8S,9S,10R,13S,14S)-16-hydroxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-ylidene]ethyl acetate.
| Compound Name | 2-[(8S,9S,10R,13S,14S)-16-hydroxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-ylidene]ethyl acetate |
|---|---|
| PubChem CID | 154143087 |
| Molecular Formula | C23H30O5 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 2-[(8S,9S,10R,13S,14S)-16-hydroxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-ylidene]ethyl acetate |
| SMILES | CC(=O)OCC=C1C(O)C[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3C(=O)C[C@]12C |
| InChI | InChI=1S/C23H30O5/c1-13(24)28-9-7-17-19(26)11-18-16-5-4-14-10-15(25)6-8-22(14,2)21(16)20(27)12-23(17,18)3/h7,10,16,18-19,21,26H,4-6,8-9,11-12H2,1-3H3/t16-,18-,19?,21+,22-,23+/m0/s1 |
| InChIKey | DUQCAKBBUVESMO-JYOVTCOOSA-N |
| XLogP | 3.16 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'steroid_A(2)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|