C20H28O3 — CID 123475004
17-acetyl-12-hydroxy-10-methyl-2,6,7,8,9,11,12,13,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 123475004) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is 17-acetyl-12-hydroxy-10-methyl-2,6,7,8,9,11,12,13,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | 17-acetyl-12-hydroxy-10-methyl-2,6,7,8,9,11,12,13,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 123475004 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | 17-acetyl-12-hydroxy-10-methyl-2,6,7,8,9,11,12,13,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC(=O)C1CCC2C3CCC4=CC(=O)CCC4(C)C3CC(O)C12 |
| InChI | InChI=1S/C20H28O3/c1-11(21)14-5-6-16-15-4-3-12-9-13(22)7-8-20(12,2)17(15)10-18(23)19(14)16/h9,14-19,23H,3-8,10H2,1-2H3 |
| InChIKey | LEWYPUJFICFQRF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |