C22H30O4 — CID 90455059
[2-(10-methyl-3-oxo-2,6,7,8,9,11,12,13,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-oxoethyl] acetate (PubChem CID 90455059) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is [2-(10-methyl-3-oxo-2,6,7,8,9,11,12,13,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-oxoethyl] acetate.
| Compound Name | [2-(10-methyl-3-oxo-2,6,7,8,9,11,12,13,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 90455059 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | [2-(10-methyl-3-oxo-2,6,7,8,9,11,12,13,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)C1CCC2C1CCC1C2CCC2=CC(=O)CCC21C |
| InChI | InChI=1S/C22H30O4/c1-13(23)26-12-21(25)19-6-5-16-17(19)7-8-20-18(16)4-3-14-11-15(24)9-10-22(14,20)2/h11,16-20H,3-10,12H2,1-2H3 |
| InChIKey | WIXOLICRVYUIMP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |