C28H25NO2 — CID 125036947
(1S,3S,6S,8S,9S,13S)-14-[(4-methylphenyl)methylidene]-11-phenyl-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-2(7)-ene-10,12-dione (PubChem CID 125036947) has the molecular formula C28H25NO2 and a molecular weight of 407.51 g/mol. Its IUPAC name is (1S,3S,6S,8S,9S,13S)-14-[(4-methylphenyl)methylidene]-11-phenyl-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-2(7)-ene-10,12-dione.
| Compound Name | (1S,3S,6S,8S,9S,13S)-14-[(4-methylphenyl)methylidene]-11-phenyl-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-2(7)-ene-10,12-dione |
|---|---|
| PubChem CID | 125036947 |
| Molecular Formula | C28H25NO2 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | (1S,3S,6S,8S,9S,13S)-14-[(4-methylphenyl)methylidene]-11-phenyl-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-2(7)-ene-10,12-dione |
| SMILES | Cc1ccc(C=C2[C@H]3C4=C([C@H]5CC[C@H]4C5)[C@H]2[C@@H]2C(=O)N(c4ccccc4)C(=O)[C@@H]32)cc1 |
| InChI | InChI=1S/C28H25NO2/c1-15-7-9-16(10-8-15)13-20-23-21-17-11-12-18(14-17)22(21)24(20)26-25(23)27(30)29(28(26)31)19-5-3-2-4-6-19/h2-10,13,17-18,23-26H,11-12,14H2,1H3/t17-,18-,23-,24-,25-,26-/m0/s1 |
| InChIKey | ZOTSTQGCNJLBTR-SFYJKWEMSA-N |
| XLogP | 5.17 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|