C24H20ClNO2 — CID 102134276
(1S,2R,6S,7R,8S,10R)-9-[(4-chlorophenyl)methylidene]-4-(4-methylphenyl)-4-azatetracyclo[5.3.1.02,6.08,10]undecane-3,5-dione (PubChem CID 102134276) has the molecular formula C24H20ClNO2 and a molecular weight of 389.88 g/mol. Its IUPAC name is (1S,2R,6S,7R,8S,10R)-9-[(4-chlorophenyl)methylidene]-4-(4-methylphenyl)-4-azatetracyclo[5.3.1.02,6.08,10]undecane-3,5-dione.
| Compound Name | (1S,2R,6S,7R,8S,10R)-9-[(4-chlorophenyl)methylidene]-4-(4-methylphenyl)-4-azatetracyclo[5.3.1.02,6.08,10]undecane-3,5-dione |
|---|---|
| PubChem CID | 102134276 |
| Molecular Formula | C24H20ClNO2 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | (1S,2R,6S,7R,8S,10R)-9-[(4-chlorophenyl)methylidene]-4-(4-methylphenyl)-4-azatetracyclo[5.3.1.02,6.08,10]undecane-3,5-dione |
| SMILES | Cc1ccc(N2C(=O)[C@@H]3[C@H]4C[C@@H]([C@@H]3C2=O)[C@@H]2/C(=C\c3ccc(Cl)cc3)[C@H]42)cc1 |
| InChI | InChI=1S/C24H20ClNO2/c1-12-2-8-15(9-3-12)26-23(27)21-17-11-18(22(21)24(26)28)20-16(19(17)20)10-13-4-6-14(25)7-5-13/h2-10,17-22H,11H2,1H3/b16-10-/t17-,18+,19+,20-,21+,22-/m0/s1 |
| InChIKey | NTSRPINPKJVFCJ-KIYMSEGUSA-N |
| XLogP | 4.73 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|