C12H19NO4 — CID 125041660
ethyl (1R,2S,6S,7S,9R)-4,4-dimethyl-3,5-dioxa-8-azatricyclo[5.2.1.02,6]decane-9-carboxylate (PubChem CID 125041660) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is ethyl (1R,2S,6S,7S,9R)-4,4-dimethyl-3,5-dioxa-8-azatricyclo[5.2.1.02,6]decane-9-carboxylate.
| Compound Name | ethyl (1R,2S,6S,7S,9R)-4,4-dimethyl-3,5-dioxa-8-azatricyclo[5.2.1.02,6]decane-9-carboxylate |
|---|---|
| PubChem CID | 125041660 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | ethyl (1R,2S,6S,7S,9R)-4,4-dimethyl-3,5-dioxa-8-azatricyclo[5.2.1.02,6]decane-9-carboxylate |
| SMILES | CCOC(=O)[C@@H]1N[C@H]2C[C@H]1[C@@H]1OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C12H19NO4/c1-4-15-11(14)8-6-5-7(13-8)10-9(6)16-12(2,3)17-10/h6-10,13H,4-5H2,1-3H3/t6-,7+,8-,9+,10+/m1/s1 |
| InChIKey | JJQYWHISCWGHHN-KGDYZURWSA-N |
| XLogP | 0.43 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |