C15H21NO2 — CID 125042035
(2R)-2-[(2R)-1-methylpiperidin-2-yl]-3,4-dihydro-2H-chromen-5-ol (PubChem CID 125042035) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is (2R)-2-[(2R)-1-methylpiperidin-2-yl]-3,4-dihydro-2H-chromen-5-ol.
| Compound Name | (2R)-2-[(2R)-1-methylpiperidin-2-yl]-3,4-dihydro-2H-chromen-5-ol |
|---|---|
| PubChem CID | 125042035 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | (2R)-2-[(2R)-1-methylpiperidin-2-yl]-3,4-dihydro-2H-chromen-5-ol |
| SMILES | CN1CCCC[C@@H]1[C@H]1CCc2c(O)cccc2O1 |
| InChI | InChI=1S/C15H21NO2/c1-16-10-3-2-5-12(16)15-9-8-11-13(17)6-4-7-14(11)18-15/h4,6-7,12,15,17H,2-3,5,8-10H2,1H3/t12-,15-/m1/s1 |
| InChIKey | SAFAEJVPQFBPCV-IUODEOHRSA-N |
| XLogP | 2.57 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |