C15H19NO2 — CID 177479111
(1S,9R)-11-methyl-8-oxa-11-azatetracyclo[8.3.3.01,9.02,7]hexadeca-2(7),3,5-trien-6-ol (PubChem CID 177479111) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is (1S,9R)-11-methyl-8-oxa-11-azatetracyclo[8.3.3.01,9.02,7]hexadeca-2(7),3,5-trien-6-ol.
| Compound Name | (1S,9R)-11-methyl-8-oxa-11-azatetracyclo[8.3.3.01,9.02,7]hexadeca-2(7),3,5-trien-6-ol |
|---|---|
| PubChem CID | 177479111 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | (1S,9R)-11-methyl-8-oxa-11-azatetracyclo[8.3.3.01,9.02,7]hexadeca-2(7),3,5-trien-6-ol |
| SMILES | CN1CC[C@]23CCCC1[C@@H]2Oc1c(O)cccc13 |
| InChI | InChI=1S/C15H19NO2/c1-16-9-8-15-7-3-5-11(16)14(15)18-13-10(15)4-2-6-12(13)17/h2,4,6,11,14,17H,3,5,7-9H2,1H3/t11?,14-,15-/m0/s1 |
| InChIKey | NEEUHMCLVMVASY-CNSWMUILSA-N |
| XLogP | 2.28 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |