C15H20N2O — CID 11288027
(1S,9R,10S)-11-methyl-8-oxa-11-azatetracyclo[8.3.3.01,9.02,7]hexadeca-2(7),3,5-trien-6-amine (PubChem CID 11288027) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is (1S,9R,10S)-11-methyl-8-oxa-11-azatetracyclo[8.3.3.01,9.02,7]hexadeca-2(7),3,5-trien-6-amine.
| Compound Name | (1S,9R,10S)-11-methyl-8-oxa-11-azatetracyclo[8.3.3.01,9.02,7]hexadeca-2(7),3,5-trien-6-amine |
|---|---|
| PubChem CID | 11288027 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | (1S,9R,10S)-11-methyl-8-oxa-11-azatetracyclo[8.3.3.01,9.02,7]hexadeca-2(7),3,5-trien-6-amine |
| SMILES | CN1CC[C@]23CCC[C@H]1[C@@H]2Oc1c(N)cccc13 |
| InChI | InChI=1S/C15H20N2O/c1-17-9-8-15-7-3-6-12(17)14(15)18-13-10(15)4-2-5-11(13)16/h2,4-5,12,14H,3,6-9,16H2,1H3/t12-,14-,15-/m0/s1 |
| InChIKey | PSOQOBXMDXEKIV-QEJZJMRPSA-N |
| XLogP | 2.16 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|