C22H26N2O — CID 25180470
(1S,9R,12R)-13-(2-phenylethyl)-8-oxa-13-azatetracyclo[10.3.1.01,9.02,7]hexadeca-2(7),3,5-trien-6-amine (PubChem CID 25180470) has the molecular formula C22H26N2O and a molecular weight of 334.46 g/mol. Its IUPAC name is (1S,9R,12R)-13-(2-phenylethyl)-8-oxa-13-azatetracyclo[10.3.1.01,9.02,7]hexadeca-2(7),3,5-trien-6-amine.
| Compound Name | (1S,9R,12R)-13-(2-phenylethyl)-8-oxa-13-azatetracyclo[10.3.1.01,9.02,7]hexadeca-2(7),3,5-trien-6-amine |
|---|---|
| PubChem CID | 25180470 |
| Molecular Formula | C22H26N2O |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | (1S,9R,12R)-13-(2-phenylethyl)-8-oxa-13-azatetracyclo[10.3.1.01,9.02,7]hexadeca-2(7),3,5-trien-6-amine |
| SMILES | Nc1cccc2c1O[C@@H]1CC[C@@H]3C[C@@]21CCN3CCc1ccccc1 |
| InChI | InChI=1S/C22H26N2O/c23-19-8-4-7-18-21(19)25-20-10-9-17-15-22(18,20)12-14-24(17)13-11-16-5-2-1-3-6-16/h1-8,17,20H,9-15,23H2/t17-,20-,22+/m1/s1 |
| InChIKey | YHECPVYIPUUEDT-ZNLUXHQJSA-N |
| XLogP | 3.77 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|