C21H23NO2 — CID 25180674
(1S,9R,12S)-11-benzyl-8-oxa-11-azatetracyclo[10.3.1.01,9.02,7]hexadeca-2(7),3,5-trien-6-ol (PubChem CID 25180674) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is (1S,9R,12S)-11-benzyl-8-oxa-11-azatetracyclo[10.3.1.01,9.02,7]hexadeca-2(7),3,5-trien-6-ol.
| Compound Name | (1S,9R,12S)-11-benzyl-8-oxa-11-azatetracyclo[10.3.1.01,9.02,7]hexadeca-2(7),3,5-trien-6-ol |
|---|---|
| PubChem CID | 25180674 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | (1S,9R,12S)-11-benzyl-8-oxa-11-azatetracyclo[10.3.1.01,9.02,7]hexadeca-2(7),3,5-trien-6-ol |
| SMILES | Oc1cccc2c1O[C@H]1CN(Cc3ccccc3)[C@H]3CCC[C@]21C3 |
| InChI | InChI=1S/C21H23NO2/c23-18-10-4-9-17-20(18)24-19-14-22(13-15-6-2-1-3-7-15)16-8-5-11-21(17,19)12-16/h1-4,6-7,9-10,16,19,23H,5,8,11-14H2/t16-,19-,21-/m0/s1 |
| InChIKey | ICZFNCKEAZWBCM-LRQRDZAKSA-N |
| XLogP | 3.85 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |