C24H29NO2 — CID 71541564
(1R,8R,10S,11S)-12-(2-phenylethyl)-12-azatetracyclo[9.3.3.01,10.02,7]heptadeca-2(7),3,5-triene-6,8-diol (PubChem CID 71541564) has the molecular formula C24H29NO2 and a molecular weight of 363.50 g/mol. Its IUPAC name is (1R,8R,10S,11S)-12-(2-phenylethyl)-12-azatetracyclo[9.3.3.01,10.02,7]heptadeca-2(7),3,5-triene-6,8-diol.
| Compound Name | (1R,8R,10S,11S)-12-(2-phenylethyl)-12-azatetracyclo[9.3.3.01,10.02,7]heptadeca-2(7),3,5-triene-6,8-diol |
|---|---|
| PubChem CID | 71541564 |
| Molecular Formula | C24H29NO2 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | (1R,8R,10S,11S)-12-(2-phenylethyl)-12-azatetracyclo[9.3.3.01,10.02,7]heptadeca-2(7),3,5-triene-6,8-diol |
| SMILES | Oc1cccc2c1[C@H](O)C[C@@H]1[C@@H]3CCC[C@]21CCN3CCc1ccccc1 |
| InChI | InChI=1S/C24H29NO2/c26-21-10-4-8-18-23(21)22(27)16-19-20-9-5-12-24(18,19)13-15-25(20)14-11-17-6-2-1-3-7-17/h1-4,6-8,10,19-20,22,26-27H,5,9,11-16H2/t19-,20+,22-,24+/m1/s1 |
| InChIKey | SZKFJUBIXAITBN-ADGBJGEGSA-N |
| XLogP | 4.18 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |