C23H27ClN2O3S — CID 125043116
4-chloro-N-[[4-[(3S)-3-methylpiperidine-1-carbonyl]phenyl]methyl]-N-prop-2-enylbenzenesulfonamide (PubChem CID 125043116) has the molecular formula C23H27ClN2O3S and a molecular weight of 447.00 g/mol. Its IUPAC name is 4-chloro-N-[[4-[(3S)-3-methylpiperidine-1-carbonyl]phenyl]methyl]-N-prop-2-enylbenzenesulfonamide.
| Compound Name | 4-chloro-N-[[4-[(3S)-3-methylpiperidine-1-carbonyl]phenyl]methyl]-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 125043116 |
| Molecular Formula | C23H27ClN2O3S |
| Molecular Weight | 447.00 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 4-chloro-N-[[4-[(3S)-3-methylpiperidine-1-carbonyl]phenyl]methyl]-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCN(Cc1ccc(C(=O)N2CCC[C@H](C)C2)cc1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H27ClN2O3S/c1-3-14-26(30(28,29)22-12-10-21(24)11-13-22)17-19-6-8-20(9-7-19)23(27)25-15-4-5-18(2)16-25/h3,6-13,18H,1,4-5,14-17H2,2H3/t18-/m0/s1 |
| InChIKey | KXLLYLYHZXMBLQ-SFHVURJKSA-N |
| XLogP | 4.59 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.00 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|