C26H36N2O2 — CID 125044572
(2S)-2-(2,4-dimethylphenoxy)-N-[(1R)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]butanamide (PubChem CID 125044572) has the molecular formula C26H36N2O2 and a molecular weight of 408.59 g/mol. Its IUPAC name is (2S)-2-(2,4-dimethylphenoxy)-N-[(1R)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]butanamide.
| Compound Name | (2S)-2-(2,4-dimethylphenoxy)-N-[(1R)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]butanamide |
|---|---|
| PubChem CID | 125044572 |
| Molecular Formula | C26H36N2O2 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.28 |
| IUPAC Name | (2S)-2-(2,4-dimethylphenoxy)-N-[(1R)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]butanamide |
| SMILES | CC[C@H](Oc1ccc(C)cc1C)C(=O)N[C@H](C)c1ccc(N2CCC[C@H](C)C2)cc1 |
| InChI | InChI=1S/C26H36N2O2/c1-6-24(30-25-14-9-18(2)16-20(25)4)26(29)27-21(5)22-10-12-23(13-11-22)28-15-7-8-19(3)17-28/h9-14,16,19,21,24H,6-8,15,17H2,1-5H3,(H,27,29)/t19-,21+,24-/m0/s1 |
| InChIKey | LQYOJZCCCQWQCW-LEEZEASISA-N |
| XLogP | 5.57 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|