C20H24FNO2 — CID 53289006
2-(2,4-dimethylphenoxy)-N-[1-(4-fluorophenyl)ethyl]butanamide (PubChem CID 53289006) has the molecular formula C20H24FNO2 and a molecular weight of 329.42 g/mol. Its IUPAC name is 2-(2,4-dimethylphenoxy)-N-[1-(4-fluorophenyl)ethyl]butanamide.
| Compound Name | 2-(2,4-dimethylphenoxy)-N-[1-(4-fluorophenyl)ethyl]butanamide |
|---|---|
| PubChem CID | 53289006 |
| Molecular Formula | C20H24FNO2 |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | 2-(2,4-dimethylphenoxy)-N-[1-(4-fluorophenyl)ethyl]butanamide |
| SMILES | CCC(Oc1ccc(C)cc1C)C(=O)NC(C)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H24FNO2/c1-5-18(24-19-11-6-13(2)12-14(19)3)20(23)22-15(4)16-7-9-17(21)10-8-16/h6-12,15,18H,5H2,1-4H3,(H,22,23) |
| InChIKey | YPBVHLVTGIMCRP-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |