C20H24FNO4 — CID 93488009
(2S)-N-[(1S)-1-(3,4-dimethoxyphenyl)ethyl]-2-(4-fluorophenoxy)butanamide (PubChem CID 93488009) has the molecular formula C20H24FNO4 and a molecular weight of 361.41 g/mol. Its IUPAC name is (2S)-N-[(1S)-1-(3,4-dimethoxyphenyl)ethyl]-2-(4-fluorophenoxy)butanamide.
| Compound Name | (2S)-N-[(1S)-1-(3,4-dimethoxyphenyl)ethyl]-2-(4-fluorophenoxy)butanamide |
|---|---|
| PubChem CID | 93488009 |
| Molecular Formula | C20H24FNO4 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | (2S)-N-[(1S)-1-(3,4-dimethoxyphenyl)ethyl]-2-(4-fluorophenoxy)butanamide |
| SMILES | CC[C@H](Oc1ccc(F)cc1)C(=O)N[C@@H](C)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C20H24FNO4/c1-5-17(26-16-9-7-15(21)8-10-16)20(23)22-13(2)14-6-11-18(24-3)19(12-14)25-4/h6-13,17H,5H2,1-4H3,(H,22,23)/t13-,17-/m0/s1 |
| InChIKey | WDGIYTTVRFBTLB-GUYCJALGSA-N |
| XLogP | 3.88 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |