C5H11N2S+ — CID 12504485
3-methyl-2-methylsulfanyl-4,5-dihydro-1H-imidazol-3-ium (PubChem CID 12504485) has the molecular formula C5H11N2S+ and a molecular weight of 131.22 g/mol. Its IUPAC name is 3-methyl-2-methylsulfanyl-4,5-dihydro-1H-imidazol-3-ium.
| Compound Name | 3-methyl-2-methylsulfanyl-4,5-dihydro-1H-imidazol-3-ium |
|---|---|
| PubChem CID | 12504485 |
| Molecular Formula | C5H11N2S+ |
| Molecular Weight | 131.22 g/mol |
| Exact Mass | 131.06 |
| IUPAC Name | 3-methyl-2-methylsulfanyl-4,5-dihydro-1H-imidazol-3-ium |
| SMILES | CSC1=[N+](C)CCN1 |
| InChI | InChI=1S/C5H10N2S/c1-7-4-3-6-5(7)8-2/h3-4H2,1-2H3/p+1 |
| InChIKey | PTFFWCHVBDAOMF-UHFFFAOYSA-O |
| XLogP | -0.05 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.22 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|