C6H13IN2S — CID 12504486
3-ethyl-2-methylsulfanyl-4,5-dihydro-1H-imidazol-3-ium iodide (PubChem CID 12504486) has the molecular formula C6H13IN2S and a molecular weight of 272.15 g/mol. Its IUPAC name is 3-ethyl-2-methylsulfanyl-4,5-dihydro-1H-imidazol-3-ium iodide.
| Compound Name | 3-ethyl-2-methylsulfanyl-4,5-dihydro-1H-imidazol-3-ium iodide |
|---|---|
| PubChem CID | 12504486 |
| Molecular Formula | C6H13IN2S |
| Molecular Weight | 272.15 g/mol |
| Exact Mass | 271.98 |
| IUPAC Name | 3-ethyl-2-methylsulfanyl-4,5-dihydro-1H-imidazol-3-ium iodide |
| SMILES | CC[N+]1=C(SC)NCC1.[I-] |
| InChI | InChI=1S/C6H12N2S.HI/c1-3-8-5-4-7-6(8)9-2;/h3-5H2,1-2H3;1H |
| InChIKey | XYVHFWFANDCINZ-UHFFFAOYSA-N |
| XLogP | -2.65 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.15 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|