About 1-ethyl-2-methylsulfanyl-4,5-dihydroimidazole
1-ethyl-2-methylsulfanyl-4,5-dihydroimidazole (PubChem CID 12504492) has the molecular formula C6H12N2S
and a molecular weight of 144.24 g/mol. Its IUPAC name is 1-ethyl-2-methylsulfanyl-4,5-dihydroimidazole.
Analyze 1-ethyl-2-methylsulfanyl-4,5-dihydroimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2-methylsulfanyl-4,5-dihydroimidazole?
The IUPAC name of 1-ethyl-2-methylsulfanyl-4,5-dihydroimidazole (CID 12504492) is 1-ethyl-2-methylsulfanyl-4,5-dihydroimidazole.
What is the SMILES notation for 1-ethyl-2-methylsulfanyl-4,5-dihydroimidazole?
The canonical SMILES for 1-ethyl-2-methylsulfanyl-4,5-dihydroimidazole is CCN1CCN=C1SC.
What is the InChIKey of 1-ethyl-2-methylsulfanyl-4,5-dihydroimidazole?
The InChIKey is UUKHHDQBZOVMIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2S/c1-3-8-5-4-7-6(8)9-2/h3-5H2,1-2H3.
What are the key properties of 1-ethyl-2-methylsulfanyl-4,5-dihydroimidazole?
1-ethyl-2-methylsulfanyl-4,5-dihydroimidazole has a molecular weight of 144.24 g/mol, XLogP of 1.04, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2-methylsulfanyl-4,5-dihydroimidazole is sourced from PubChem (CID 12504492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).