(2R)-2-(N,4-diethylanilino)butanoic acid

C14H21NO2 — CID 125044983

IUPAC(2R)-2-(N,4-diethylanilino)butanoic acid
SMILESCCc1ccc(N(CC)[C@H](CC)C(=O)O)cc1
InChIInChI=1S/C14H21NO2/c1-4-11-7-9-12(10-8-11)15(6-3)13(5-2)14(16)17/h7-10,13H,4-6H2,1-3H3,(H,16,17)/t13-/m1/s1
InChIKeyCSRZWLMKQVMINV-CYBMUJFWSA-N
MW235.33 g/mol
LogP2.94
Rot. Bonds6

About (2R)-2-(N,4-diethylanilino)butanoic acid

(2R)-2-(N,4-diethylanilino)butanoic acid (PubChem CID 125044983) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is (2R)-2-(N,4-diethylanilino)butanoic acid.

Molecular Properties

Compound Name(2R)-2-(N,4-diethylanilino)butanoic acid
PubChem CID125044983
Molecular FormulaC14H21NO2
Molecular Weight235.33 g/mol
Exact Mass235.16
IUPAC Name(2R)-2-(N,4-diethylanilino)butanoic acid
SMILESCCc1ccc(N(CC)[C@H](CC)C(=O)O)cc1
InChIInChI=1S/C14H21NO2/c1-4-11-7-9-12(10-8-11)15(6-3)13(5-2)14(16)17/h7-10,13H,4-6H2,1-3H3,(H,16,17)/t13-/m1/s1
InChIKeyCSRZWLMKQVMINV-CYBMUJFWSA-N
XLogP2.94
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500235.33
LogP ≤ 52.94
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}

Analyze (2R)-2-(N,4-diethylanilino)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(2S)-2-(N,4-diethylanilino)butanoic acid
CID 100518092
2-(N-ethyl-4-trimethylsilylanilino)butanoic acid
CID 59058633
(2R)-2-(4-ethyl-N-methylsulfonylanilino)butanoic acid
CID 124746692
2-(N-ethyl-3,5-dimethylanilino)butanoic acid
CID 133150265
(2R)-2-(N-ethyl-3,5-dimethylanilino)butanoic acid
CID 100517927
2-(diethylamino)-3-(4-ethylphenyl)propanoic acid
CID 83969905
(2R)-2-(4-ethyl-N-propylanilino)propanoic acid
CID 125045091
(2S)-2-(4-methyl-N-propylanilino)butanoic acid
CID 100517320
(2S)-2-[N-ethyl-3-(trifluoromethyl)anilino]butanoic acid
CID 100520434
(2R)-2-(N-ethyl-3-nitroanilino)butanoic acid
CID 100521914
(2S)-2-(N-ethylanilino)pent-4-enoic acid
CID 67199848
(2S)-2-(4-phenoxy-N-propylanilino)butanoic acid
CID 100521174

Frequently Asked Questions

What is the IUPAC name of (2R)-2-(N,4-diethylanilino)butanoic acid?
The IUPAC name of (2R)-2-(N,4-diethylanilino)butanoic acid (CID 125044983) is (2R)-2-(N,4-diethylanilino)butanoic acid.
What is the SMILES notation for (2R)-2-(N,4-diethylanilino)butanoic acid?
The canonical SMILES for (2R)-2-(N,4-diethylanilino)butanoic acid is CCc1ccc(N(CC)[C@H](CC)C(=O)O)cc1.
What is the InChIKey of (2R)-2-(N,4-diethylanilino)butanoic acid?
The InChIKey is CSRZWLMKQVMINV-CYBMUJFWSA-N. The full InChI is InChI=1S/C14H21NO2/c1-4-11-7-9-12(10-8-11)15(6-3)13(5-2)14(16)17/h7-10,13H,4-6H2,1-3H3,(H,16,17)/t13-/m1/s1.
What are the key properties of (2R)-2-(N,4-diethylanilino)butanoic acid?
(2R)-2-(N,4-diethylanilino)butanoic acid has a molecular weight of 235.33 g/mol, XLogP of 2.94, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(N,4-diethylanilino)butanoic acid is sourced from PubChem (CID 125044983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).