2-(N-ethyl-3,5-dimethylanilino)butanoic acid

C14H21NO2 — CID 133150265

IUPAC2-(N-ethyl-3,5-dimethylanilino)butanoic acid
SMILESCCC(C(=O)O)N(CC)c1cc(C)cc(C)c1
InChIInChI=1S/C14H21NO2/c1-5-13(14(16)17)15(6-2)12-8-10(3)7-11(4)9-12/h7-9,13H,5-6H2,1-4H3,(H,16,17)
InChIKeyQFPLKIVXIUJAKZ-UHFFFAOYSA-N
MW235.33 g/mol
LogP2.99
Rot. Bonds5

About 2-(N-ethyl-3,5-dimethylanilino)butanoic acid

2-(N-ethyl-3,5-dimethylanilino)butanoic acid (PubChem CID 133150265) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is 2-(N-ethyl-3,5-dimethylanilino)butanoic acid.

Molecular Properties

Compound Name2-(N-ethyl-3,5-dimethylanilino)butanoic acid
PubChem CID133150265
Molecular FormulaC14H21NO2
Molecular Weight235.33 g/mol
Exact Mass235.16
IUPAC Name2-(N-ethyl-3,5-dimethylanilino)butanoic acid
SMILESCCC(C(=O)O)N(CC)c1cc(C)cc(C)c1
InChIInChI=1S/C14H21NO2/c1-5-13(14(16)17)15(6-2)12-8-10(3)7-11(4)9-12/h7-9,13H,5-6H2,1-4H3,(H,16,17)
InChIKeyQFPLKIVXIUJAKZ-UHFFFAOYSA-N
XLogP2.99
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500235.33
LogP ≤ 52.99
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-(N-ethyl-3,5-dimethylanilino)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(N-ethyl-3,5-dimethylanilino)butanoic acid?
The IUPAC name of 2-(N-ethyl-3,5-dimethylanilino)butanoic acid (CID 133150265) is 2-(N-ethyl-3,5-dimethylanilino)butanoic acid.
What is the SMILES notation for 2-(N-ethyl-3,5-dimethylanilino)butanoic acid?
The canonical SMILES for 2-(N-ethyl-3,5-dimethylanilino)butanoic acid is CCC(C(=O)O)N(CC)c1cc(C)cc(C)c1.
What is the InChIKey of 2-(N-ethyl-3,5-dimethylanilino)butanoic acid?
The InChIKey is QFPLKIVXIUJAKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO2/c1-5-13(14(16)17)15(6-2)12-8-10(3)7-11(4)9-12/h7-9,13H,5-6H2,1-4H3,(H,16,17).
What are the key properties of 2-(N-ethyl-3,5-dimethylanilino)butanoic acid?
2-(N-ethyl-3,5-dimethylanilino)butanoic acid has a molecular weight of 235.33 g/mol, XLogP of 2.99, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(N-ethyl-3,5-dimethylanilino)butanoic acid is sourced from PubChem (CID 133150265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).