C13H18ClNO2 — CID 100519415
(2R)-2-(3-chloro-N-ethyl-2-methylanilino)butanoic acid (PubChem CID 100519415) has the molecular formula C13H18ClNO2 and a molecular weight of 255.74 g/mol. Its IUPAC name is (2R)-2-(3-chloro-N-ethyl-2-methylanilino)butanoic acid.
| Compound Name | (2R)-2-(3-chloro-N-ethyl-2-methylanilino)butanoic acid |
|---|---|
| PubChem CID | 100519415 |
| Molecular Formula | C13H18ClNO2 |
| Molecular Weight | 255.74 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | (2R)-2-(3-chloro-N-ethyl-2-methylanilino)butanoic acid |
| SMILES | CC[C@H](C(=O)O)N(CC)c1cccc(Cl)c1C |
| InChI | InChI=1S/C13H18ClNO2/c1-4-11(13(16)17)15(5-2)12-8-6-7-10(14)9(12)3/h6-8,11H,4-5H2,1-3H3,(H,16,17)/t11-/m1/s1 |
| InChIKey | QNYMYLNERFQOPW-LLVKDONJSA-N |
| XLogP | 3.34 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.74 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |