C14H18ClNO4 — CID 82317224
3-[N-(1-carboxyethyl)-3-chloro-2-methylanilino]-2-methylpropanoic acid (PubChem CID 82317224) has the molecular formula C14H18ClNO4 and a molecular weight of 299.75 g/mol. Its IUPAC name is 3-[N-(1-carboxyethyl)-3-chloro-2-methylanilino]-2-methylpropanoic acid.
| Compound Name | 3-[N-(1-carboxyethyl)-3-chloro-2-methylanilino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 82317224 |
| Molecular Formula | C14H18ClNO4 |
| Molecular Weight | 299.75 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 3-[N-(1-carboxyethyl)-3-chloro-2-methylanilino]-2-methylpropanoic acid |
| SMILES | Cc1c(Cl)cccc1N(CC(C)C(=O)O)C(C)C(=O)O |
| InChI | InChI=1S/C14H18ClNO4/c1-8(13(17)18)7-16(10(3)14(19)20)12-6-4-5-11(15)9(12)2/h4-6,8,10H,7H2,1-3H3,(H,17,18)(H,19,20) |
| InChIKey | ZVDSGSPPQJXTDZ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.75 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |