C14H16OS — CID 12504866
5,5-dimethyl-3-phenylsulfanylcyclohex-2-en-1-one (PubChem CID 12504866) has the molecular formula C14H16OS and a molecular weight of 232.35 g/mol. Its IUPAC name is 5,5-dimethyl-3-phenylsulfanylcyclohex-2-en-1-one.
| Compound Name | 5,5-dimethyl-3-phenylsulfanylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 12504866 |
| Molecular Formula | C14H16OS |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 5,5-dimethyl-3-phenylsulfanylcyclohex-2-en-1-one |
| SMILES | CC1(C)CC(=O)C=C(Sc2ccccc2)C1 |
| InChI | InChI=1S/C14H16OS/c1-14(2)9-11(15)8-13(10-14)16-12-6-4-3-5-7-12/h3-8H,9-10H2,1-2H3 |
| InChIKey | WBOIOGDUVSHSJX-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |