C26H37N3O4S — CID 125052438
(2R)-2-[4-[methyl(methylsulfonyl)amino]phenoxy]-N-[(1R)-1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]butanamide (PubChem CID 125052438) has the molecular formula C26H37N3O4S and a molecular weight of 487.67 g/mol. Its IUPAC name is (2R)-2-[4-[methyl(methylsulfonyl)amino]phenoxy]-N-[(1R)-1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]butanamide.
| Compound Name | (2R)-2-[4-[methyl(methylsulfonyl)amino]phenoxy]-N-[(1R)-1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]butanamide |
|---|---|
| PubChem CID | 125052438 |
| Molecular Formula | C26H37N3O4S |
| Molecular Weight | 487.67 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | (2R)-2-[4-[methyl(methylsulfonyl)amino]phenoxy]-N-[(1R)-1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]butanamide |
| SMILES | CC[C@@H](Oc1ccc(N(C)S(C)(=O)=O)cc1)C(=O)N[C@H](C)c1ccc(N2CCC(C)CC2)cc1 |
| InChI | InChI=1S/C26H37N3O4S/c1-6-25(33-24-13-11-22(12-14-24)28(4)34(5,31)32)26(30)27-20(3)21-7-9-23(10-8-21)29-17-15-19(2)16-18-29/h7-14,19-20,25H,6,15-18H2,1-5H3,(H,27,30)/t20-,25-/m1/s1 |
| InChIKey | FXBTXTFYTBUEJJ-CJFMBICVSA-N |
| XLogP | 4.35 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.67 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|