C25H35N3O4S — CID 125052848
(2R)-2-[4-[methyl(methylsulfonyl)amino]phenoxy]-N-[(1S)-1-[4-[(3R)-3-methylpiperidin-1-yl]phenyl]ethyl]propanamide (PubChem CID 125052848) has the molecular formula C25H35N3O4S and a molecular weight of 473.64 g/mol. Its IUPAC name is (2R)-2-[4-[methyl(methylsulfonyl)amino]phenoxy]-N-[(1S)-1-[4-[(3R)-3-methylpiperidin-1-yl]phenyl]ethyl]propanamide.
| Compound Name | (2R)-2-[4-[methyl(methylsulfonyl)amino]phenoxy]-N-[(1S)-1-[4-[(3R)-3-methylpiperidin-1-yl]phenyl]ethyl]propanamide |
|---|---|
| PubChem CID | 125052848 |
| Molecular Formula | C25H35N3O4S |
| Molecular Weight | 473.64 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | (2R)-2-[4-[methyl(methylsulfonyl)amino]phenoxy]-N-[(1S)-1-[4-[(3R)-3-methylpiperidin-1-yl]phenyl]ethyl]propanamide |
| SMILES | C[C@@H]1CCCN(c2ccc([C@H](C)NC(=O)[C@@H](C)Oc3ccc(N(C)S(C)(=O)=O)cc3)cc2)C1 |
| InChI | InChI=1S/C25H35N3O4S/c1-18-7-6-16-28(17-18)23-10-8-21(9-11-23)19(2)26-25(29)20(3)32-24-14-12-22(13-15-24)27(4)33(5,30)31/h8-15,18-20H,6-7,16-17H2,1-5H3,(H,26,29)/t18-,19+,20-/m1/s1 |
| InChIKey | GYJWRTSLACRBSV-HSALFYBXSA-N |
| XLogP | 3.96 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.64 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|