C11H12N2OS — CID 12505543
3-anilino-4,5-dimethyl-1,3-thiazol-2-one (PubChem CID 12505543) has the molecular formula C11H12N2OS and a molecular weight of 220.30 g/mol. Its IUPAC name is 3-anilino-4,5-dimethyl-1,3-thiazol-2-one.
| Compound Name | 3-anilino-4,5-dimethyl-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 12505543 |
| Molecular Formula | C11H12N2OS |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 3-anilino-4,5-dimethyl-1,3-thiazol-2-one |
| SMILES | Cc1sc(=O)n(Nc2ccccc2)c1C |
| InChI | InChI=1S/C11H12N2OS/c1-8-9(2)15-11(14)13(8)12-10-6-4-3-5-7-10/h3-7,12H,1-2H3 |
| InChIKey | WPXVBVZUJJPCSV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |