C13H15N3O2S — CID 134908093
ethyl 3-anilino-2-imino-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 134908093) has the molecular formula C13H15N3O2S and a molecular weight of 277.35 g/mol. Its IUPAC name is ethyl 3-anilino-2-imino-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 3-anilino-2-imino-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 134908093 |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | ethyl 3-anilino-2-imino-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | [H]/N=c1\sc(C(=O)OCC)c(C)n1Nc1ccccc1 |
| InChI | InChI=1S/C13H15N3O2S/c1-3-18-12(17)11-9(2)16(13(14)19-11)15-10-7-5-4-6-8-10/h4-8,14-15H,3H2,1-2H3/b14-13- |
| InChIKey | BGSUBLWAGHXNMC-YPKPFQOOSA-N |
| XLogP | 2.39 |
| TPSA | 67.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |