C32H39N3O5S — CID 125056153
(2R)-2-[benzyl-[2-(N-(4-ethoxyphenyl)sulfonylanilino)acetyl]amino]-N-cyclohexylpropanamide (PubChem CID 125056153) has the molecular formula C32H39N3O5S and a molecular weight of 577.75 g/mol. Its IUPAC name is (2R)-2-[benzyl-[2-(N-(4-ethoxyphenyl)sulfonylanilino)acetyl]amino]-N-cyclohexylpropanamide.
| Compound Name | (2R)-2-[benzyl-[2-(N-(4-ethoxyphenyl)sulfonylanilino)acetyl]amino]-N-cyclohexylpropanamide |
|---|---|
| PubChem CID | 125056153 |
| Molecular Formula | C32H39N3O5S |
| Molecular Weight | 577.75 g/mol |
| Exact Mass | 577.26 |
| IUPAC Name | (2R)-2-[benzyl-[2-(N-(4-ethoxyphenyl)sulfonylanilino)acetyl]amino]-N-cyclohexylpropanamide |
| SMILES | CCOc1ccc(S(=O)(=O)N(CC(=O)N(Cc2ccccc2)[C@H](C)C(=O)NC2CCCCC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H39N3O5S/c1-3-40-29-19-21-30(22-20-29)41(38,39)35(28-17-11-6-12-18-28)24-31(36)34(23-26-13-7-4-8-14-26)25(2)32(37)33-27-15-9-5-10-16-27/h4,6-8,11-14,17-22,25,27H,3,5,9-10,15-16,23-24H2,1-2H3,(H,33,37)/t25-/m1/s1 |
| InChIKey | JLKYHTIUJKULJP-RUZDIDTESA-N |
| XLogP | 5.15 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.75 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |