C20H22ClN3O2S — CID 125056899
5-chloro-2-ethoxy-4-[(3S,5R,6S)-3-ethyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-5-yl]phenol (PubChem CID 125056899) has the molecular formula C20H22ClN3O2S and a molecular weight of 403.94 g/mol. Its IUPAC name is 5-chloro-2-ethoxy-4-[(3S,5R,6S)-3-ethyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-5-yl]phenol.
| Compound Name | 5-chloro-2-ethoxy-4-[(3S,5R,6S)-3-ethyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-5-yl]phenol |
|---|---|
| PubChem CID | 125056899 |
| Molecular Formula | C20H22ClN3O2S |
| Molecular Weight | 403.94 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 5-chloro-2-ethoxy-4-[(3S,5R,6S)-3-ethyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-5-yl]phenol |
| SMILES | CCOc1cc([C@@H]2[C@@H](c3ccccn3)N=C3SC[C@H](CC)N32)c(Cl)cc1O |
| InChI | InChI=1S/C20H22ClN3O2S/c1-3-12-11-27-20-23-18(15-7-5-6-8-22-15)19(24(12)20)13-9-17(26-4-2)16(25)10-14(13)21/h5-10,12,18-19,25H,3-4,11H2,1-2H3/t12-,18+,19+/m0/s1 |
| InChIKey | ZLXDCLUODYGBPT-GESALYCCSA-N |
| XLogP | 4.82 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.94 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |