C19H21N3S — CID 125056927
(3R,5S,6R)-3-ethyl-5-(2-methylphenyl)-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole (PubChem CID 125056927) has the molecular formula C19H21N3S and a molecular weight of 323.46 g/mol. Its IUPAC name is (3R,5S,6R)-3-ethyl-5-(2-methylphenyl)-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole.
| Compound Name | (3R,5S,6R)-3-ethyl-5-(2-methylphenyl)-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 125056927 |
| Molecular Formula | C19H21N3S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | (3R,5S,6R)-3-ethyl-5-(2-methylphenyl)-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
| SMILES | CC[C@@H]1CSC2=N[C@@H](c3ccccn3)[C@H](c3ccccc3C)N21 |
| InChI | InChI=1S/C19H21N3S/c1-3-14-12-23-19-21-17(16-10-6-7-11-20-16)18(22(14)19)15-9-5-4-8-13(15)2/h4-11,14,17-18H,3,12H2,1-2H3/t14-,17+,18+/m1/s1 |
| InChIKey | ZYDSTRKZULHDRE-JLSDUUJJSA-N |
| XLogP | 4.37 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |