C25H28N4S — CID 133180818
5-(1-benzyl-2,5-dimethylpyrrol-3-yl)-3-ethyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole (PubChem CID 133180818) has the molecular formula C25H28N4S and a molecular weight of 416.59 g/mol. Its IUPAC name is 5-(1-benzyl-2,5-dimethylpyrrol-3-yl)-3-ethyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole.
| Compound Name | 5-(1-benzyl-2,5-dimethylpyrrol-3-yl)-3-ethyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 133180818 |
| Molecular Formula | C25H28N4S |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 5-(1-benzyl-2,5-dimethylpyrrol-3-yl)-3-ethyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
| SMILES | CCC1CSC2=NC(c3ccccn3)C(c3cc(C)n(Cc4ccccc4)c3C)N21 |
| InChI | InChI=1S/C25H28N4S/c1-4-20-16-30-25-27-23(22-12-8-9-13-26-22)24(29(20)25)21-14-17(2)28(18(21)3)15-19-10-6-5-7-11-19/h5-14,20,23-24H,4,15-16H2,1-3H3 |
| InChIKey | LEFCVQTYQVQHSP-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |