C24H27N5S — CID 125056553
(3R,5S,6S)-5-[2,5-dimethyl-1-(3-methyl-2-pyridinyl)pyrrol-3-yl]-3-ethyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole (PubChem CID 125056553) has the molecular formula C24H27N5S and a molecular weight of 417.58 g/mol. Its IUPAC name is (3R,5S,6S)-5-[2,5-dimethyl-1-(3-methyl-2-pyridinyl)pyrrol-3-yl]-3-ethyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole.
| Compound Name | (3R,5S,6S)-5-[2,5-dimethyl-1-(3-methyl-2-pyridinyl)pyrrol-3-yl]-3-ethyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 125056553 |
| Molecular Formula | C24H27N5S |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | (3R,5S,6S)-5-[2,5-dimethyl-1-(3-methyl-2-pyridinyl)pyrrol-3-yl]-3-ethyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
| SMILES | CC[C@@H]1CSC2=N[C@H](c3ccccn3)[C@H](c3cc(C)n(-c4ncccc4C)c3C)N21 |
| InChI | InChI=1S/C24H27N5S/c1-5-18-14-30-24-27-21(20-10-6-7-11-25-20)22(29(18)24)19-13-16(3)28(17(19)4)23-15(2)9-8-12-26-23/h6-13,18,21-22H,5,14H2,1-4H3/t18-,21-,22+/m1/s1 |
| InChIKey | WEOKKAXNFPVBRL-QIJUGHKUSA-N |
| XLogP | 5.17 |
| TPSA | 46.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|