C24H25BrN4S — CID 125050950
(3R,5S,6S)-5-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-3-ethyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole (PubChem CID 125050950) has the molecular formula C24H25BrN4S and a molecular weight of 481.46 g/mol. Its IUPAC name is (3R,5S,6S)-5-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-3-ethyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole.
| Compound Name | (3R,5S,6S)-5-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-3-ethyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 125050950 |
| Molecular Formula | C24H25BrN4S |
| Molecular Weight | 481.46 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | (3R,5S,6S)-5-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-3-ethyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
| SMILES | CC[C@@H]1CSC2=N[C@H](c3ccccn3)[C@H](c3cc(C)n(-c4ccc(Br)cc4)c3C)N21 |
| InChI | InChI=1S/C24H25BrN4S/c1-4-18-14-30-24-27-22(21-7-5-6-12-26-21)23(29(18)24)20-13-15(2)28(16(20)3)19-10-8-17(25)9-11-19/h5-13,18,22-23H,4,14H2,1-3H3/t18-,22-,23+/m1/s1 |
| InChIKey | BANQDBWMQSLWRA-YSZBQJHXSA-N |
| XLogP | 6.23 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.46 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|