C23H28N4OS — CID 133180770
4-[4-(3-ethyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-5-yl)-3-methylphenyl]morpholine (PubChem CID 133180770) has the molecular formula C23H28N4OS and a molecular weight of 408.57 g/mol. Its IUPAC name is 4-[4-(3-ethyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-5-yl)-3-methylphenyl]morpholine.
| Compound Name | 4-[4-(3-ethyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-5-yl)-3-methylphenyl]morpholine |
|---|---|
| PubChem CID | 133180770 |
| Molecular Formula | C23H28N4OS |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 4-[4-(3-ethyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-5-yl)-3-methylphenyl]morpholine |
| SMILES | CCC1CSC2=NC(c3ccccn3)C(c3ccc(N4CCOCC4)cc3C)N21 |
| InChI | InChI=1S/C23H28N4OS/c1-3-17-15-29-23-25-21(20-6-4-5-9-24-20)22(27(17)23)19-8-7-18(14-16(19)2)26-10-12-28-13-11-26/h4-9,14,17,21-22H,3,10-13,15H2,1-2H3 |
| InChIKey | DVGVASKTFSPAJY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 40.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|