C24H30N4S — CID 133180760
5-(2,5-dimethyl-4-pyrrolidin-1-ylphenyl)-3-ethyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole (PubChem CID 133180760) has the molecular formula C24H30N4S and a molecular weight of 406.60 g/mol. Its IUPAC name is 5-(2,5-dimethyl-4-pyrrolidin-1-ylphenyl)-3-ethyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole.
| Compound Name | 5-(2,5-dimethyl-4-pyrrolidin-1-ylphenyl)-3-ethyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 133180760 |
| Molecular Formula | C24H30N4S |
| Molecular Weight | 406.60 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | 5-(2,5-dimethyl-4-pyrrolidin-1-ylphenyl)-3-ethyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
| SMILES | CCC1CSC2=NC(c3ccccn3)C(c3cc(C)c(N4CCCC4)cc3C)N21 |
| InChI | InChI=1S/C24H30N4S/c1-4-18-15-29-24-26-22(20-9-5-6-10-25-20)23(28(18)24)19-13-17(3)21(14-16(19)2)27-11-7-8-12-27/h5-6,9-10,13-14,18,22-23H,4,7-8,11-12,15H2,1-3H3 |
| InChIKey | QOEFDZRLXYXSLJ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 31.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.60 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|