C23H28N4OS — CID 125051894
(3R,5S,6R)-3-ethyl-5-(3-methoxy-4-pyrrolidin-1-ylphenyl)-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole (PubChem CID 125051894) has the molecular formula C23H28N4OS and a molecular weight of 408.57 g/mol. Its IUPAC name is (3R,5S,6R)-3-ethyl-5-(3-methoxy-4-pyrrolidin-1-ylphenyl)-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole.
| Compound Name | (3R,5S,6R)-3-ethyl-5-(3-methoxy-4-pyrrolidin-1-ylphenyl)-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 125051894 |
| Molecular Formula | C23H28N4OS |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | (3R,5S,6R)-3-ethyl-5-(3-methoxy-4-pyrrolidin-1-ylphenyl)-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
| SMILES | CC[C@@H]1CSC2=N[C@@H](c3ccccn3)[C@H](c3ccc(N4CCCC4)c(OC)c3)N21 |
| InChI | InChI=1S/C23H28N4OS/c1-3-17-15-29-23-25-21(18-8-4-5-11-24-18)22(27(17)23)16-9-10-19(20(14-16)28-2)26-12-6-7-13-26/h4-5,8-11,14,17,21-22H,3,6-7,12-13,15H2,1-2H3/t17-,21+,22+/m1/s1 |
| InChIKey | GAFCFUAEPZYHAF-WTNAPCKOSA-N |
| XLogP | 4.67 |
| TPSA | 40.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|