C22H28N4S — CID 125056308
N,N-diethyl-4-[(3R,5S,6R)-3-ethyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-5-yl]aniline (PubChem CID 125056308) has the molecular formula C22H28N4S and a molecular weight of 380.56 g/mol. Its IUPAC name is N,N-diethyl-4-[(3R,5S,6R)-3-ethyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-5-yl]aniline.
| Compound Name | N,N-diethyl-4-[(3R,5S,6R)-3-ethyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-5-yl]aniline |
|---|---|
| PubChem CID | 125056308 |
| Molecular Formula | C22H28N4S |
| Molecular Weight | 380.56 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | N,N-diethyl-4-[(3R,5S,6R)-3-ethyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-5-yl]aniline |
| SMILES | CC[C@@H]1CSC2=N[C@@H](c3ccccn3)[C@H](c3ccc(N(CC)CC)cc3)N21 |
| InChI | InChI=1S/C22H28N4S/c1-4-17-15-27-22-24-20(19-9-7-8-14-23-19)21(26(17)22)16-10-12-18(13-11-16)25(5-2)6-3/h7-14,17,20-21H,4-6,15H2,1-3H3/t17-,20+,21+/m1/s1 |
| InChIKey | VJKXSGDNWXCDNU-QMMLZNLJSA-N |
| XLogP | 4.91 |
| TPSA | 31.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.56 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|