C21H23N5OS — CID 125055592
5-[(3R,5S,6R)-3-ethyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-5-yl]-1,3-dimethylbenzimidazol-2-one (PubChem CID 125055592) has the molecular formula C21H23N5OS and a molecular weight of 393.52 g/mol. Its IUPAC name is 5-[(3R,5S,6R)-3-ethyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-5-yl]-1,3-dimethylbenzimidazol-2-one.
| Compound Name | 5-[(3R,5S,6R)-3-ethyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-5-yl]-1,3-dimethylbenzimidazol-2-one |
|---|---|
| PubChem CID | 125055592 |
| Molecular Formula | C21H23N5OS |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 5-[(3R,5S,6R)-3-ethyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-5-yl]-1,3-dimethylbenzimidazol-2-one |
| SMILES | CC[C@@H]1CSC2=N[C@@H](c3ccccn3)[C@H](c3ccc4c(c3)n(C)c(=O)n4C)N21 |
| InChI | InChI=1S/C21H23N5OS/c1-4-14-12-28-20-23-18(15-7-5-6-10-22-15)19(26(14)20)13-8-9-16-17(11-13)25(3)21(27)24(16)2/h5-11,14,18-19H,4,12H2,1-3H3/t14-,18+,19+/m1/s1 |
| InChIKey | QULJPQLJGSUYKP-CCKFTAQKSA-N |
| XLogP | 3.25 |
| TPSA | 55.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |