C25H28N2O5S — CID 125057558
2-[N-(benzenesulfonyl)-3,4-dimethoxyanilino]-N-[(2R)-2-phenylpropyl]acetamide (PubChem CID 125057558) has the molecular formula C25H28N2O5S and a molecular weight of 468.58 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3,4-dimethoxyanilino]-N-[(2R)-2-phenylpropyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3,4-dimethoxyanilino]-N-[(2R)-2-phenylpropyl]acetamide |
|---|---|
| PubChem CID | 125057558 |
| Molecular Formula | C25H28N2O5S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3,4-dimethoxyanilino]-N-[(2R)-2-phenylpropyl]acetamide |
| SMILES | COc1ccc(N(CC(=O)NC[C@H](C)c2ccccc2)S(=O)(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C25H28N2O5S/c1-19(20-10-6-4-7-11-20)17-26-25(28)18-27(33(29,30)22-12-8-5-9-13-22)21-14-15-23(31-2)24(16-21)32-3/h4-16,19H,17-18H2,1-3H3,(H,26,28)/t19-/m0/s1 |
| InChIKey | KMIQJBGBFBBMTN-IBGZPJMESA-N |
| XLogP | 3.82 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |